C41H30N6O2 — CID 142713550
[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1H-benzimidazole-4-carboxylate (PubChem CID 142713550) has the molecular formula C41H30N6O2 and a molecular weight of 638.73 g/mol. Its IUPAC name is [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1H-benzimidazole-4-carboxylate.
| Compound Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 142713550 |
| Molecular Formula | C41H30N6O2 |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1H-benzimidazole-4-carboxylate |
| SMILES | O=C(OCc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C41H30N6O2/c48-40(36-21-12-22-37-38(36)43-28-42-37)49-27-29-23-25-30(26-24-29)34-19-10-11-20-35(34)39-44-45-46-47(39)41(31-13-4-1-5-14-31,32-15-6-2-7-16-32)33-17-8-3-9-18-33/h1-26,28H,27H2,(H,42,43) |
| InChIKey | URBZTHAAIXNMEP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|