C18H26ClN2O3+ — CID 8931624
ethyl 1-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8931624) has the molecular formula C18H26ClN2O3+ and a molecular weight of 353.87 g/mol. Its IUPAC name is ethyl 1-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8931624 |
| Molecular Formula | C18H26ClN2O3+ |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | ethyl 1-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)NCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-2-24-18(23)15-8-11-21(12-9-15)13-17(22)20-10-7-14-3-5-16(19)6-4-14/h3-6,15H,2,7-13H2,1H3,(H,20,22)/p+1 |
| InChIKey | HTLDVUPZVICDRG-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |