C13H19N2O4S+ — CID 6939714
ethyl 1-[(5-nitrothiophen-2-yl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 6939714) has the molecular formula C13H19N2O4S+ and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 1-[(5-nitrothiophen-2-yl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(5-nitrothiophen-2-yl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 6939714 |
| Molecular Formula | C13H19N2O4S+ |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | ethyl 1-[(5-nitrothiophen-2-yl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C13H18N2O4S/c1-2-19-13(16)10-5-7-14(8-6-10)9-11-3-4-12(20-11)15(17)18/h3-4,10H,2,5-9H2,1H3/p+1 |
| InChIKey | RXPVAANKJVKBED-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|