C18H23N3O3 — CID 135612942
ethyl 1-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]piperidine-4-carboxylate (PubChem CID 135612942) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 1-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135612942 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethyl 1-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN([C@H](C)c2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-24-18(23)13-8-10-21(11-9-13)12(2)16-19-15-7-5-4-6-14(15)17(22)20-16/h4-7,12-13H,3,8-11H2,1-2H3,(H,19,20,22)/t12-/m1/s1 |
| InChIKey | ZDRWVEGXILQGLU-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |