C27H26F2N4O — CID 135954337
2-[(1R)-1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 135954337) has the molecular formula C27H26F2N4O and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[(1R)-1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135954337 |
| Molecular Formula | C27H26F2N4O |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[(1R)-1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H26F2N4O/c1-18(26-30-24-5-3-2-4-23(24)27(34)31-26)32-14-16-33(17-15-32)25(19-6-10-21(28)11-7-19)20-8-12-22(29)13-9-20/h2-13,18,25H,14-17H2,1H3,(H,30,31,34)/t18-/m1/s1 |
| InChIKey | SDLSYSYRSPSYPP-GOSISDBHSA-N |
| XLogP | 4.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |