C18H20N4O3S2 — CID 135927456
2-[(1R)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one (PubChem CID 135927456) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[(1R)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135927456 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[(1R)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-13(17-19-15-6-3-2-5-14(15)18(23)20-17)21-8-10-22(11-9-21)27(24,25)16-7-4-12-26-16/h2-7,12-13H,8-11H2,1H3,(H,19,20,23)/t13-/m1/s1 |
| InChIKey | ZIMJGJHATQPSIV-CYBMUJFWSA-N |
| XLogP | 2.05 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |