C20H21N3O5S2 — CID 135901140
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 135901140) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 135901140 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | C[C@@H](OC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H21N3O5S2/c1-13(18-21-16-6-3-2-5-15(16)19(24)22-18)28-20(25)14-8-10-23(11-9-14)30(26,27)17-7-4-12-29-17/h2-7,12-14H,8-11H2,1H3,(H,21,22,24)/t13-/m1/s1 |
| InChIKey | ZVODDDFZBICPCS-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |