C21H23BrN4O3S — CID 135941959
2-[(1R)-1-[4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 135941959) has the molecular formula C21H23BrN4O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-[4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135941959 |
| Molecular Formula | C21H23BrN4O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-[(1R)-1-[4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | Cc1cc(S(=O)(=O)N2CCN([C@H](C)c3nc4ccccc4c(=O)[nH]3)CC2)ccc1Br |
| InChI | InChI=1S/C21H23BrN4O3S/c1-14-13-16(7-8-18(14)22)30(28,29)26-11-9-25(10-12-26)15(2)20-23-19-6-4-3-5-17(19)21(27)24-20/h3-8,13,15H,9-12H2,1-2H3,(H,23,24,27)/t15-/m1/s1 |
| InChIKey | UZQIDNJUEZYCDC-OAHLLOKOSA-N |
| XLogP | 3.06 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |