C20H23N4O2+ — CID 135612919
2-[(1R)-1-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 135612919) has the molecular formula C20H23N4O2+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135612919 |
| Molecular Formula | C20H23N4O2+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[(1R)-1-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C20H22N4O2/c1-14(19-21-18-5-3-2-4-17(18)20(26)22-19)23-10-12-24(13-11-23)15-6-8-16(25)9-7-15/h2-9,14,25H,10-13H2,1H3,(H,21,22,26)/p+1/t14-/m1/s1 |
| InChIKey | MOEODAILXVLZHR-CQSZACIVSA-O |
| XLogP | 1.09 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |