C20H22FN4O3S+ — CID 135808016
2-[(1S)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 135808016) has the molecular formula C20H22FN4O3S+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(1S)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1S)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135808016 |
| Molecular Formula | C20H22FN4O3S+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[(1S)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@@H](c1nc2ccccc2c(=O)[nH]1)[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H21FN4O3S/c1-14(19-22-17-8-4-2-6-15(17)20(26)23-19)24-10-12-25(13-11-24)29(27,28)18-9-5-3-7-16(18)21/h2-9,14H,10-13H2,1H3,(H,22,23,26)/p+1/t14-/m0/s1 |
| InChIKey | GSBXMVVVHLAXHH-AWEZNQCLSA-O |
| XLogP | 0.71 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |