C22H26N3O+ — CID 135612925
2-[(1R)-1-(4-benzylpiperidin-1-ium-1-yl)ethyl]-3H-quinazolin-4-one (PubChem CID 135612925) has the molecular formula C22H26N3O+ and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[(1R)-1-(4-benzylpiperidin-1-ium-1-yl)ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(4-benzylpiperidin-1-ium-1-yl)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135612925 |
| Molecular Formula | C22H26N3O+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[(1R)-1-(4-benzylpiperidin-1-ium-1-yl)ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O/c1-16(21-23-20-10-6-5-9-19(20)22(26)24-21)25-13-11-18(12-14-25)15-17-7-3-2-4-8-17/h2-10,16,18H,11-15H2,1H3,(H,23,24,26)/p+1/t16-/m1/s1 |
| InChIKey | KSUXPFZJYNCRHV-MRXNPFEDSA-O |
| XLogP | 2.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |