C19H22N3O+ — CID 135808777
methyl-[(4-methylphenyl)methyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium (PubChem CID 135808777) has the molecular formula C19H22N3O+ and a molecular weight of 308.41 g/mol. Its IUPAC name is methyl-[(4-methylphenyl)methyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium.
| Compound Name | methyl-[(4-methylphenyl)methyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 135808777 |
| Molecular Formula | C19H22N3O+ |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | methyl-[(4-methylphenyl)methyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)[C@@H](C)c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-13-8-10-15(11-9-13)12-22(3)14(2)18-20-17-7-5-4-6-16(17)19(23)21-18/h4-11,14H,12H2,1-3H3,(H,20,21,23)/p+1/t14-/m0/s1 |
| InChIKey | VQFRNTCFJNXPBC-AWEZNQCLSA-O |
| XLogP | 2.01 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |