C17H23N4O3+ — CID 135729573
methyl-(2-morpholin-4-yl-2-oxoethyl)-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium (PubChem CID 135729573) has the molecular formula C17H23N4O3+ and a molecular weight of 331.40 g/mol. Its IUPAC name is methyl-(2-morpholin-4-yl-2-oxoethyl)-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium.
| Compound Name | methyl-(2-morpholin-4-yl-2-oxoethyl)-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 135729573 |
| Molecular Formula | C17H23N4O3+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl-(2-morpholin-4-yl-2-oxoethyl)-[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)[NH+](C)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H22N4O3/c1-12(20(2)11-15(22)21-7-9-24-10-8-21)16-18-14-6-4-3-5-13(14)17(23)19-16/h3-6,12H,7-11H2,1-2H3,(H,18,19,23)/p+1/t12-/m1/s1 |
| InChIKey | LYGFTRKNFHONCY-GFCCVEGCSA-O |
| XLogP | -0.64 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |