C20H29N2O3S+ — CID 2336265
(2R)-1-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 2336265) has the molecular formula C20H29N2O3S+ and a molecular weight of 377.53 g/mol. Its IUPAC name is (2R)-1-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 2336265 |
| Molecular Formula | C20H29N2O3S+ |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (2R)-1-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CCOc1ccccc1N1CC[NH+](C[C@@H](O)COCc2cccs2)CC1 |
| InChI | InChI=1S/C20H28N2O3S/c1-2-25-20-8-4-3-7-19(20)22-11-9-21(10-12-22)14-17(23)15-24-16-18-6-5-13-26-18/h3-8,13,17,23H,2,9-12,14-16H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | VXJJPKRBBMPKFF-QGZVFWFLSA-O |
| XLogP | 1.43 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |