C23H33N2O3+ — CID 7150415
(2R)-1-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(2S)-2-phenylpropoxy]propan-2-ol (PubChem CID 7150415) has the molecular formula C23H33N2O3+ and a molecular weight of 385.53 g/mol. Its IUPAC name is (2R)-1-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(2S)-2-phenylpropoxy]propan-2-ol.
| Compound Name | (2R)-1-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(2S)-2-phenylpropoxy]propan-2-ol |
|---|---|
| PubChem CID | 7150415 |
| Molecular Formula | C23H33N2O3+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (2R)-1-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-3-[(2S)-2-phenylpropoxy]propan-2-ol |
| SMILES | COc1ccccc1N1CC[NH+](C[C@@H](O)COC[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N2O3/c1-19(20-8-4-3-5-9-20)17-28-18-21(26)16-24-12-14-25(15-13-24)22-10-6-7-11-23(22)27-2/h3-11,19,21,26H,12-18H2,1-2H3/p+1/t19-,21-/m1/s1 |
| InChIKey | KIFPRKKBHVXVKI-TZIWHRDSSA-O |
| XLogP | 1.58 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |