C20H24N2O2 — CID 42234256
4-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate (PubChem CID 42234256) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate.
| Compound Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 42234256 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
| SMILES | Cc1cccc(N2CC[NH+](Cc3ccc(C(=O)[O-])cc3)CC2)c1C |
| InChI | InChI=1S/C20H24N2O2/c1-15-4-3-5-19(16(15)2)22-12-10-21(11-13-22)14-17-6-8-18(9-7-17)20(23)24/h3-9H,10-14H2,1-2H3,(H,23,24) |
| InChIKey | XWLIAZDSZUYZGK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |