C22H30N4O4 — CID 111133431
methyl 5-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111133431) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111133431 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | methyl 5-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-5-23-22(24-15-17-14-18(16(2)30-17)21(27)29-4)26-12-10-25(11-13-26)19-8-6-7-9-20(19)28-3/h6-9,14H,5,10-13,15H2,1-4H3,(H,23,24) |
| InChIKey | YBFKWNMWGCRNCY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|