C18H24NO2+ — CID 7385672
(2S)-1-naphthalen-1-yloxy-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 7385672) has the molecular formula C18H24NO2+ and a molecular weight of 286.39 g/mol. Its IUPAC name is (2S)-1-naphthalen-1-yloxy-3-piperidin-1-ium-1-ylpropan-2-ol.
| Compound Name | (2S)-1-naphthalen-1-yloxy-3-piperidin-1-ium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 7385672 |
| Molecular Formula | C18H24NO2+ |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S)-1-naphthalen-1-yloxy-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | O[C@H](COc1cccc2ccccc12)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C18H23NO2/c20-16(13-19-11-4-1-5-12-19)14-21-18-10-6-8-15-7-2-3-9-17(15)18/h2-3,6-10,16,20H,1,4-5,11-14H2/p+1/t16-/m0/s1 |
| InChIKey | YIGFKEFULNCVMP-INIZCTEOSA-O |
| XLogP | 1.65 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |