C18H22NO4+ — CID 110182843
1-(2-hydroxy-3-naphthalen-1-yloxypropyl)pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 110182843) has the molecular formula C18H22NO4+ and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 110182843 |
| Molecular Formula | C18H22NO4+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | O=C(O)C1CCC[NH+]1CC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C18H21NO4/c20-14(11-19-10-4-8-16(19)18(21)22)12-23-17-9-3-6-13-5-1-2-7-15(13)17/h1-3,5-7,9,14,16,20H,4,8,10-12H2,(H,21,22)/p+1 |
| InChIKey | ZNBCLUJASAIEAI-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |