C28H32N2O4+2 — CID 7231462
(1R)-2-[4-[(1S)-1-hydroxy-2-naphthalen-1-yloxyethyl]piperazine-1,4-diium-1-yl]-1-naphthalen-1-yloxyethanol (PubChem CID 7231462) has the molecular formula C28H32N2O4+2 and a molecular weight of 460.57 g/mol. Its IUPAC name is (1R)-2-[4-[(1S)-1-hydroxy-2-naphthalen-1-yloxyethyl]piperazine-1,4-diium-1-yl]-1-naphthalen-1-yloxyethanol.
| Compound Name | (1R)-2-[4-[(1S)-1-hydroxy-2-naphthalen-1-yloxyethyl]piperazine-1,4-diium-1-yl]-1-naphthalen-1-yloxyethanol |
|---|---|
| PubChem CID | 7231462 |
| Molecular Formula | C28H32N2O4+2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (1R)-2-[4-[(1S)-1-hydroxy-2-naphthalen-1-yloxyethyl]piperazine-1,4-diium-1-yl]-1-naphthalen-1-yloxyethanol |
| SMILES | O[C@@H](C[NH+]1CC[NH+]([C@@H](O)COc2cccc3ccccc23)CC1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C28H30N2O4/c31-27(20-33-25-13-5-9-21-7-1-3-11-23(21)25)30-17-15-29(16-18-30)19-28(32)34-26-14-6-10-22-8-2-4-12-24(22)26/h1-14,27-28,31-32H,15-20H2/p+2/t27-,28+/m0/s1 |
| InChIKey | IBBWUMPSGLGEJG-WUFINQPMSA-P |
| XLogP | 0.87 |
| TPSA | 67.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|