C20H32N2O4 — CID 7875002
ethyl 4-[[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]amino]piperidine-1-carboxylate (PubChem CID 7875002) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 7875002 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | ethyl 4-[[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC[C@H](O)COc2ccccc2C(C)C)CC1 |
| InChI | InChI=1S/C20H32N2O4/c1-4-25-20(24)22-11-9-16(10-12-22)21-13-17(23)14-26-19-8-6-5-7-18(19)15(2)3/h5-8,15-17,21,23H,4,9-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | CRUTZQVLIPAPBJ-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |