C11H16ClNO5S — CID 2849083
[3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-methylsulfamic acid (PubChem CID 2849083) has the molecular formula C11H16ClNO5S and a molecular weight of 309.77 g/mol. Its IUPAC name is [3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-methylsulfamic acid.
| Compound Name | [3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 2849083 |
| Molecular Formula | C11H16ClNO5S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | [3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-methylsulfamic acid |
| SMILES | Cc1cc(OCC(O)CN(C)S(=O)(=O)O)ccc1Cl |
| InChI | InChI=1S/C11H16ClNO5S/c1-8-5-10(3-4-11(8)12)18-7-9(14)6-13(2)19(15,16)17/h3-5,9,14H,6-7H2,1-2H3,(H,15,16,17) |
| InChIKey | GYLSKXLZOIFOKQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|