C16H28INO2 — CID 3064891
[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-dimethyl-propan-2-ylazanium iodide (PubChem CID 3064891) has the molecular formula C16H28INO2 and a molecular weight of 393.31 g/mol. Its IUPAC name is [3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-dimethyl-propan-2-ylazanium iodide.
| Compound Name | [3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-dimethyl-propan-2-ylazanium iodide |
|---|---|
| PubChem CID | 3064891 |
| Molecular Formula | C16H28INO2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-dimethyl-propan-2-ylazanium iodide |
| SMILES | Cc1cccc(C)c1OCC(O)C[N+](C)(C)C(C)C.[I-] |
| InChI | InChI=1S/C16H28NO2.HI/c1-12(2)17(5,6)10-15(18)11-19-16-13(3)8-7-9-14(16)4;/h7-9,12,15,18H,10-11H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | CAMDNIPFRHEEIQ-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|