C10H15NO3 — CID 143628110
2-(3-amino-2-hydroxypropoxy)-3-methylphenol (PubChem CID 143628110) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(3-amino-2-hydroxypropoxy)-3-methylphenol.
| Compound Name | 2-(3-amino-2-hydroxypropoxy)-3-methylphenol |
|---|---|
| PubChem CID | 143628110 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(3-amino-2-hydroxypropoxy)-3-methylphenol |
| SMILES | Cc1cccc(O)c1OCC(O)CN |
| InChI | InChI=1S/C10H15NO3/c1-7-3-2-4-9(13)10(7)14-6-8(12)5-11/h2-4,8,12-13H,5-6,11H2,1H3 |
| InChIKey | HXWQXWMVXXTQPZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |