C17H23ClN6O4 — CID 88659484
N-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethyl]-N-(6-hydrazinylpyridazin-3-yl)oxyacetamide (PubChem CID 88659484) has the molecular formula C17H23ClN6O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is N-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethyl]-N-(6-hydrazinylpyridazin-3-yl)oxyacetamide.
| Compound Name | N-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethyl]-N-(6-hydrazinylpyridazin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 88659484 |
| Molecular Formula | C17H23ClN6O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethyl]-N-(6-hydrazinylpyridazin-3-yl)oxyacetamide |
| SMILES | CC(=O)N(CCNCC(O)COc1ccccc1Cl)Oc1ccc(NN)nn1 |
| InChI | InChI=1S/C17H23ClN6O4/c1-12(25)24(28-17-7-6-16(21-19)22-23-17)9-8-20-10-13(26)11-27-15-5-3-2-4-14(15)18/h2-7,13,20,26H,8-11,19H2,1H3,(H,21,22) |
| InChIKey | ZDUMEZQTEYODHV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|