C18H26N6O4 — CID 88659865
N-(6-hydrazinylpyridazin-3-yl)oxy-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]acetamide (PubChem CID 88659865) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(6-hydrazinylpyridazin-3-yl)oxy-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]acetamide.
| Compound Name | N-(6-hydrazinylpyridazin-3-yl)oxy-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 88659865 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-(6-hydrazinylpyridazin-3-yl)oxy-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]acetamide |
| SMILES | CC(=O)N(CCNCC(O)COc1ccccc1C)Oc1ccc(NN)nn1 |
| InChI | InChI=1S/C18H26N6O4/c1-13-5-3-4-6-16(13)27-12-15(26)11-20-9-10-24(14(2)25)28-18-8-7-17(21-19)22-23-18/h3-8,15,20,26H,9-12,19H2,1-2H3,(H,21,22) |
| InChIKey | IGRZPTXRTIOSIC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|