C17H25Cl2N5O3 — CID 70466859
1-(2-chloro-3-methylphenoxy)-3-[1-(6-hydrazinylpyridazin-3-yl)oxypropan-2-ylamino]propan-2-ol;hydrochloride (PubChem CID 70466859) has the molecular formula C17H25Cl2N5O3 and a molecular weight of 418.33 g/mol. Its IUPAC name is 1-(2-chloro-3-methylphenoxy)-3-[1-(6-hydrazinylpyridazin-3-yl)oxypropan-2-ylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-(2-chloro-3-methylphenoxy)-3-[1-(6-hydrazinylpyridazin-3-yl)oxypropan-2-ylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70466859 |
| Molecular Formula | C17H25Cl2N5O3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-(2-chloro-3-methylphenoxy)-3-[1-(6-hydrazinylpyridazin-3-yl)oxypropan-2-ylamino]propan-2-ol;hydrochloride |
| SMILES | Cc1cccc(OCC(O)CNC(C)COc2ccc(NN)nn2)c1Cl.Cl |
| InChI | InChI=1S/C17H24ClN5O3.ClH/c1-11-4-3-5-14(17(11)18)25-10-13(24)8-20-12(2)9-26-16-7-6-15(21-19)22-23-16;/h3-7,12-13,20,24H,8-10,19H2,1-2H3,(H,21,22);1H |
| InChIKey | JODHXUNPZAIQFA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|