C18H27Cl2N5O4 — CID 13288281
1-(2-chloro-4-methoxyphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride (PubChem CID 13288281) has the molecular formula C18H27Cl2N5O4 and a molecular weight of 448.35 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride.
| Compound Name | 1-(2-chloro-4-methoxyphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 13288281 |
| Molecular Formula | C18H27Cl2N5O4 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
| SMILES | COc1ccc(OCC(O)CNC(C)(C)COc2ccc(NN)nn2)c(Cl)c1.Cl |
| InChI | InChI=1S/C18H26ClN5O4.ClH/c1-18(2,11-28-17-7-6-16(22-20)23-24-17)21-9-12(25)10-27-15-5-4-13(26-3)8-14(15)19;/h4-8,12,21,25H,9-11,20H2,1-3H3,(H,22,23);1H |
| InChIKey | ORGQVCNNIXFKPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|