C17H26Cl2N6O2 — CID 13288296
1-(2-chlorophenoxy)-3-[[1-[(6-hydrazinylpyridazin-3-yl)amino]-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride (PubChem CID 13288296) has the molecular formula C17H26Cl2N6O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-[[1-[(6-hydrazinylpyridazin-3-yl)amino]-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride.
| Compound Name | 1-(2-chlorophenoxy)-3-[[1-[(6-hydrazinylpyridazin-3-yl)amino]-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 13288296 |
| Molecular Formula | C17H26Cl2N6O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-[[1-[(6-hydrazinylpyridazin-3-yl)amino]-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
| SMILES | CC(C)(CNc1ccc(NN)nn1)NCC(O)COc1ccccc1Cl.Cl |
| InChI | InChI=1S/C17H25ClN6O2.ClH/c1-17(2,11-20-15-7-8-16(22-19)24-23-15)21-9-12(25)10-26-14-6-4-3-5-13(14)18;/h3-8,12,21,25H,9-11,19H2,1-2H3,(H,20,23)(H,22,24);1H |
| InChIKey | NAFLUCPNJWJTEV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|