C17H22ClN3O3S — CID 10000057
3-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione (PubChem CID 10000057) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 3-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione.
| Compound Name | 3-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 10000057 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione |
| SMILES | CC(C)(COc1ccc(=S)[nH]n1)NCC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C17H22ClN3O3S/c1-17(2,11-24-15-7-8-16(25)21-20-15)19-9-12(22)10-23-14-6-4-3-5-13(14)18/h3-8,12,19,22H,9-11H2,1-2H3,(H,21,25) |
| InChIKey | XZMAWJVGCFDIAY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|