C18H24ClN3O3S — CID 10453448
3-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione (PubChem CID 10453448) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is 3-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione.
| Compound Name | 3-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 10453448 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]-2-methylpropoxy]-1H-pyridazine-6-thione |
| SMILES | Cc1ccc(Cl)c(OCC(O)CNC(C)(C)COc2ccc(=S)[nH]n2)c1 |
| InChI | InChI=1S/C18H24ClN3O3S/c1-12-4-5-14(19)15(8-12)24-10-13(23)9-20-18(2,3)11-25-16-6-7-17(26)22-21-16/h4-8,13,20,23H,9-11H2,1-3H3,(H,22,26) |
| InChIKey | LVOAWNFIPFSNFW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|