C18H27Cl2N5O2S — CID 70448151
1-(2-chloro-5-methylphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)sulfanyl-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride (PubChem CID 70448151) has the molecular formula C18H27Cl2N5O2S and a molecular weight of 448.42 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)sulfanyl-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride.
| Compound Name | 1-(2-chloro-5-methylphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)sulfanyl-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70448151 |
| Molecular Formula | C18H27Cl2N5O2S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-(2-chloro-5-methylphenoxy)-3-[[1-(6-hydrazinylpyridazin-3-yl)sulfanyl-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(Cl)c(OCC(O)CNC(C)(C)CSc2ccc(NN)nn2)c1.Cl |
| InChI | InChI=1S/C18H26ClN5O2S.ClH/c1-12-4-5-14(19)15(8-12)26-10-13(25)9-21-18(2,3)11-27-17-7-6-16(22-20)23-24-17;/h4-8,13,21,25H,9-11,20H2,1-3H3,(H,22,23);1H |
| InChIKey | WWAXMOQOOVTLCF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|