C20H31Cl2N5O4 — CID 70447903
1-[2-chloro-4-(2-methoxyethyl)phenoxy]-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride (PubChem CID 70447903) has the molecular formula C20H31Cl2N5O4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 1-[2-chloro-4-(2-methoxyethyl)phenoxy]-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride.
| Compound Name | 1-[2-chloro-4-(2-methoxyethyl)phenoxy]-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70447903 |
| Molecular Formula | C20H31Cl2N5O4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[2-chloro-4-(2-methoxyethyl)phenoxy]-3-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]propan-2-ol;hydrochloride |
| SMILES | COCCc1ccc(OCC(O)CNC(C)(C)COc2ccc(NN)nn2)c(Cl)c1.Cl |
| InChI | InChI=1S/C20H30ClN5O4.ClH/c1-20(2,13-30-19-7-6-18(24-22)25-26-19)23-11-15(27)12-29-17-5-4-14(8-9-28-3)10-16(17)21;/h4-7,10,15,23,27H,8-9,11-13,22H2,1-3H3,(H,24,25);1H |
| InChIKey | WLENLCQQLSPAIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|