C21H28ClNO4 — CID 3057309
4-[2-[[3-[2-chloro-4-(2-methoxyethyl)phenoxy]-2-hydroxypropyl]amino]propyl]phenol (PubChem CID 3057309) has the molecular formula C21H28ClNO4 and a molecular weight of 393.91 g/mol. Its IUPAC name is 4-[2-[[3-[2-chloro-4-(2-methoxyethyl)phenoxy]-2-hydroxypropyl]amino]propyl]phenol.
| Compound Name | 4-[2-[[3-[2-chloro-4-(2-methoxyethyl)phenoxy]-2-hydroxypropyl]amino]propyl]phenol |
|---|---|
| PubChem CID | 3057309 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[2-[[3-[2-chloro-4-(2-methoxyethyl)phenoxy]-2-hydroxypropyl]amino]propyl]phenol |
| SMILES | COCCc1ccc(OCC(O)CNC(C)Cc2ccc(O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H28ClNO4/c1-15(11-16-3-6-18(24)7-4-16)23-13-19(25)14-27-21-8-5-17(9-10-26-2)12-20(21)22/h3-8,12,15,19,23-25H,9-11,13-14H2,1-2H3 |
| InChIKey | ZSXYFMMPYCOCRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |