C17H26ClNO4 — CID 70494692
2-[[3-chloro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl]butanoic acid (PubChem CID 70494692) has the molecular formula C17H26ClNO4 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-[[3-chloro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl]butanoic acid.
| Compound Name | 2-[[3-chloro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 70494692 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[[3-chloro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ccc(OCC(O)CNC(C)C)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C17H26ClNO4/c1-4-13(17(21)22)7-12-5-6-16(15(18)8-12)23-10-14(20)9-19-11(2)3/h5-6,8,11,13-14,19-20H,4,7,9-10H2,1-3H3,(H,21,22) |
| InChIKey | OJMGOLFRCAPZOS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |