C18H25ClF3N5O3 — CID 13288277
1-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]-3-[3-(trifluoromethyl)phenoxy]propan-2-ol;hydrochloride (PubChem CID 13288277) has the molecular formula C18H25ClF3N5O3 and a molecular weight of 451.88 g/mol. Its IUPAC name is 1-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]-3-[3-(trifluoromethyl)phenoxy]propan-2-ol;hydrochloride.
| Compound Name | 1-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]-3-[3-(trifluoromethyl)phenoxy]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 13288277 |
| Molecular Formula | C18H25ClF3N5O3 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-[[1-(6-hydrazinylpyridazin-3-yl)oxy-2-methylpropan-2-yl]amino]-3-[3-(trifluoromethyl)phenoxy]propan-2-ol;hydrochloride |
| SMILES | CC(C)(COc1ccc(NN)nn1)NCC(O)COc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C18H24F3N5O3.ClH/c1-17(2,11-29-16-7-6-15(24-22)25-26-16)23-9-13(27)10-28-14-5-3-4-12(8-14)18(19,20)21;/h3-8,13,23,27H,9-11,22H2,1-2H3,(H,24,25);1H |
| InChIKey | XPKURZDXLZPYGH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|