C27H38N4O5 — CID 70586565
N'-acetyl-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]-N'-phenylpropanehydrazide;pyrrolidin-2-one (PubChem CID 70586565) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is N'-acetyl-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]-N'-phenylpropanehydrazide;pyrrolidin-2-one.
| Compound Name | N'-acetyl-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]-N'-phenylpropanehydrazide;pyrrolidin-2-one |
|---|---|
| PubChem CID | 70586565 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | N'-acetyl-N-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethyl]-N'-phenylpropanehydrazide;pyrrolidin-2-one |
| SMILES | CCC(=O)N(CCNCC(O)COc1ccccc1C)N(C(C)=O)c1ccccc1.O=C1CCCN1 |
| InChI | InChI=1S/C23H31N3O4.C4H7NO/c1-4-23(29)25(26(19(3)27)20-11-6-5-7-12-20)15-14-24-16-21(28)17-30-22-13-9-8-10-18(22)2;6-4-2-1-3-5-4/h5-13,21,24,28H,4,14-17H2,1-3H3;1-3H2,(H,5,6) |
| InChIKey | FHXYKNRMKMUOCE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|