C9H22N2O3S — CID 106147426
1-(dimethylamino)-2-methyl-3-(2-methylsulfonylethylamino)propan-2-ol (PubChem CID 106147426) has the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-(2-methylsulfonylethylamino)propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-(2-methylsulfonylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 106147426 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-(2-methylsulfonylethylamino)propan-2-ol |
| SMILES | CN(C)CC(C)(O)CNCCS(C)(=O)=O |
| InChI | InChI=1S/C9H22N2O3S/c1-9(12,8-11(2)3)7-10-5-6-15(4,13)14/h10,12H,5-8H2,1-4H3 |
| InChIKey | ZYCHPNIOKSKSNJ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|