C10H21BrN2O2 — CID 106146098
2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylpropanamide (PubChem CID 106146098) has the molecular formula C10H21BrN2O2 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 106146098 |
| Molecular Formula | C10H21BrN2O2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylpropanamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)C(C)(C)Br |
| InChI | InChI=1S/C10H21BrN2O2/c1-9(2,11)8(14)12-6-10(3,15)7-13(4)5/h15H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | GASRGPLPQCFYAQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|