C12H22N2O2 — CID 103839882
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]hexa-2,4-dienamide (PubChem CID 103839882) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]hexa-2,4-dienamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 103839882 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-5-6-7-8-11(15)13-9-12(2,16)10-14(3)4/h5-8,16H,9-10H2,1-4H3,(H,13,15) |
| InChIKey | FXBOHLZFRDKNNH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|