C20H31NO2 — CID 150590728
N-(2-hydroxy-2-methylbutyl)pentadeca-2,4,6,10,12-pentaenamide (PubChem CID 150590728) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylbutyl)pentadeca-2,4,6,10,12-pentaenamide.
| Compound Name | N-(2-hydroxy-2-methylbutyl)pentadeca-2,4,6,10,12-pentaenamide |
|---|---|
| PubChem CID | 150590728 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-(2-hydroxy-2-methylbutyl)pentadeca-2,4,6,10,12-pentaenamide |
| SMILES | CCC=CC=CCCC=CC=CC=CC(=O)NCC(C)(O)CC |
| InChI | InChI=1S/C20H31NO2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(3,23)5-2/h6-9,12-17,23H,4-5,10-11,18H2,1-3H3,(H,21,22) |
| InChIKey | IPUSKIXWNUGCMF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|