C18H29NO3 — CID 162920321
N-(2-hydroxy-2-methylpropyl)-12-oxotetradeca-2,4,8-trienamide (PubChem CID 162920321) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-12-oxotetradeca-2,4,8-trienamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-12-oxotetradeca-2,4,8-trienamide |
|---|---|
| PubChem CID | 162920321 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-12-oxotetradeca-2,4,8-trienamide |
| SMILES | CCC(=O)CCC=CCCC=CC=CC(=O)NCC(C)(C)O |
| InChI | InChI=1S/C18H29NO3/c1-4-16(20)13-11-9-7-5-6-8-10-12-14-17(21)19-15-18(2,3)22/h7-10,12,14,22H,4-6,11,13,15H2,1-3H3,(H,19,21) |
| InChIKey | VBPJOLZEHVDXMU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|