C23H35NO2 — CID 172859631
N-(2-hydroxy-2-methylpropyl)nonadeca-2,4,8,10,12,14-hexaenamide (PubChem CID 172859631) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)nonadeca-2,4,8,10,12,14-hexaenamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)nonadeca-2,4,8,10,12,14-hexaenamide |
|---|---|
| PubChem CID | 172859631 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)nonadeca-2,4,8,10,12,14-hexaenamide |
| SMILES | CCCCC=CC=CC=CC=CCCC=CC=CC(=O)NCC(C)(C)O |
| InChI | InChI=1S/C23H35NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(25)24-21-23(2,3)26/h7-14,17-20,26H,4-6,15-16,21H2,1-3H3,(H,24,25) |
| InChIKey | ZEEWFKJPPGCSOJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|