C28H47NO2 — CID 151144325
N-(2-hydroxy-2-pentylheptyl)hexadeca-2,4,8,10,12-pentaenamide (PubChem CID 151144325) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is N-(2-hydroxy-2-pentylheptyl)hexadeca-2,4,8,10,12-pentaenamide.
| Compound Name | N-(2-hydroxy-2-pentylheptyl)hexadeca-2,4,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 151144325 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | N-(2-hydroxy-2-pentylheptyl)hexadeca-2,4,8,10,12-pentaenamide |
| SMILES | CCCC=CC=CC=CCCC=CC=CC(=O)NCC(O)(CCCCC)CCCCC |
| InChI | InChI=1S/C28H47NO2/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-23-27(30)29-26-28(31,24-21-8-5-2)25-22-9-6-3/h10-15,18-20,23,31H,4-9,16-17,21-22,24-26H2,1-3H3,(H,29,30) |
| InChIKey | MWWFIZTVLVPBSU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|