C26H43NO2 — CID 150342686
N-(2-hydroxy-2-propylhexyl)heptadeca-2,6,8,10,12-pentaenamide (PubChem CID 150342686) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is N-(2-hydroxy-2-propylhexyl)heptadeca-2,6,8,10,12-pentaenamide.
| Compound Name | N-(2-hydroxy-2-propylhexyl)heptadeca-2,6,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 150342686 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | N-(2-hydroxy-2-propylhexyl)heptadeca-2,6,8,10,12-pentaenamide |
| SMILES | CCCCC=CC=CC=CC=CCCC=CC(=O)NCC(O)(CCC)CCCC |
| InChI | InChI=1S/C26H43NO2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)27-24-26(29,22-6-3)23-8-5-2/h10-17,20-21,29H,4-9,18-19,22-24H2,1-3H3,(H,27,28) |
| InChIKey | GSAOPBNLXMZNAT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|