C31H51NO2 — CID 150873593
N-(2-butyl-2-hydroxyoctyl)nonadeca-2,4,8,10,12,14-hexaenamide (PubChem CID 150873593) has the molecular formula C31H51NO2 and a molecular weight of 469.75 g/mol. Its IUPAC name is N-(2-butyl-2-hydroxyoctyl)nonadeca-2,4,8,10,12,14-hexaenamide.
| Compound Name | N-(2-butyl-2-hydroxyoctyl)nonadeca-2,4,8,10,12,14-hexaenamide |
|---|---|
| PubChem CID | 150873593 |
| Molecular Formula | C31H51NO2 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.39 |
| IUPAC Name | N-(2-butyl-2-hydroxyoctyl)nonadeca-2,4,8,10,12,14-hexaenamide |
| SMILES | CCCCC=CC=CC=CC=CCCC=CC=CC(=O)NCC(O)(CCCC)CCCCCC |
| InChI | InChI=1S/C31H51NO2/c1-4-7-10-12-13-14-15-16-17-18-19-20-21-22-23-24-26-30(33)32-29-31(34,27-9-6-3)28-25-11-8-5-2/h12-19,22-24,26,34H,4-11,20-21,25,27-29H2,1-3H3,(H,32,33) |
| InChIKey | KUNUGZADOXOIIY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|