C23H37NO2 — CID 152517013
N-(2-ethyl-2-hydroxyheptyl)tetradeca-2,6,8,10,12-pentaenamide (PubChem CID 152517013) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxyheptyl)tetradeca-2,6,8,10,12-pentaenamide.
| Compound Name | N-(2-ethyl-2-hydroxyheptyl)tetradeca-2,6,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 152517013 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | N-(2-ethyl-2-hydroxyheptyl)tetradeca-2,6,8,10,12-pentaenamide |
| SMILES | CC=CC=CC=CC=CCCC=CC(=O)NCC(O)(CC)CCCCC |
| InChI | InChI=1S/C23H37NO2/c1-4-7-9-10-11-12-13-14-15-16-17-19-22(25)24-21-23(26,6-3)20-18-8-5-2/h4,7,9-14,17,19,26H,5-6,8,15-16,18,20-21H2,1-3H3,(H,24,25) |
| InChIKey | YGSRQVMFPHNKBQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|