C24H39NO2 — CID 151325633
N-(2-ethyl-2-hydroxyhexyl)hexadeca-2,6,8,10,12-pentaenamide (PubChem CID 151325633) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxyhexyl)hexadeca-2,6,8,10,12-pentaenamide.
| Compound Name | N-(2-ethyl-2-hydroxyhexyl)hexadeca-2,6,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 151325633 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | N-(2-ethyl-2-hydroxyhexyl)hexadeca-2,6,8,10,12-pentaenamide |
| SMILES | CCCC=CC=CC=CC=CCCC=CC(=O)NCC(O)(CC)CCCC |
| InChI | InChI=1S/C24H39NO2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-23(26)25-22-24(27,6-3)21-8-5-2/h9-16,19-20,27H,4-8,17-18,21-22H2,1-3H3,(H,25,26) |
| InChIKey | OHJGMLZLFPAKSS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|