C27H45NO2 — CID 150083010
N-(2-butyl-2-hydroxyoctyl)pentadeca-2,4,6,10,12-pentaenamide (PubChem CID 150083010) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is N-(2-butyl-2-hydroxyoctyl)pentadeca-2,4,6,10,12-pentaenamide.
| Compound Name | N-(2-butyl-2-hydroxyoctyl)pentadeca-2,4,6,10,12-pentaenamide |
|---|---|
| PubChem CID | 150083010 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | N-(2-butyl-2-hydroxyoctyl)pentadeca-2,4,6,10,12-pentaenamide |
| SMILES | CCC=CC=CCCC=CC=CC=CC(=O)NCC(O)(CCCC)CCCCCC |
| InChI | InChI=1S/C27H45NO2/c1-4-7-10-12-13-14-15-16-17-18-19-20-22-26(29)28-25-27(30,23-9-6-3)24-21-11-8-5-2/h7,10,12-13,16-20,22,30H,4-6,8-9,11,14-15,21,23-25H2,1-3H3,(H,28,29) |
| InChIKey | DRQQGOPFVUUTDZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|