C18H27NO4 — CID 132575015
(2E,4E,9E,11E)-8-hydroxy-N-(2-hydroxy-2-methylpropyl)-13-oxotetradeca-2,4,9,11-tetraenamide (PubChem CID 132575015) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2E,4E,9E,11E)-8-hydroxy-N-(2-hydroxy-2-methylpropyl)-13-oxotetradeca-2,4,9,11-tetraenamide.
| Compound Name | (2E,4E,9E,11E)-8-hydroxy-N-(2-hydroxy-2-methylpropyl)-13-oxotetradeca-2,4,9,11-tetraenamide |
|---|---|
| PubChem CID | 132575015 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2E,4E,9E,11E)-8-hydroxy-N-(2-hydroxy-2-methylpropyl)-13-oxotetradeca-2,4,9,11-tetraenamide |
| SMILES | CC(=O)/C=C/C=C/C(O)CC/C=C/C=C/C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C18H27NO4/c1-15(20)10-8-9-12-16(21)11-6-4-5-7-13-17(22)19-14-18(2,3)23/h4-5,7-10,12-13,16,21,23H,6,11,14H2,1-3H3,(H,19,22)/b5-4+,10-8+,12-9+,13-7+ |
| InChIKey | TYZQAUNZFBMABP-SOHRNAHQSA-N |
| XLogP | 1.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|